C19H21N5O5S — CID 139991866
4-[[4-amino-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 139991866) has the molecular formula C19H21N5O5S and a molecular weight of 431.47 g/mol. Its IUPAC name is 4-[[4-amino-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4-amino-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 139991866 |
| Molecular Formula | C19H21N5O5S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 4-[[4-amino-6-(3,4,5-trimethoxyphenyl)pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | COc1cc(-c2cc(N)nc(Nc3ccc(S(N)(=O)=O)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21N5O5S/c1-27-15-8-11(9-16(28-2)18(15)29-3)14-10-17(20)24-19(23-14)22-12-4-6-13(7-5-12)30(21,25)26/h4-10H,1-3H3,(H2,21,25,26)(H3,20,22,23,24) |
| InChIKey | VDGGXJQIFWOHNW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 151.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |