C13H19N7O2S — CID 11688636
4-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]amino]benzenesulfonamide (PubChem CID 11688636) has the molecular formula C13H19N7O2S and a molecular weight of 337.41 g/mol. Its IUPAC name is 4-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 11688636 |
| Molecular Formula | C13H19N7O2S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 4-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]amino]benzenesulfonamide |
| SMILES | CN(C)c1nc(Nc2ccc(S(N)(=O)=O)cc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C13H19N7O2S/c1-19(2)12-16-11(17-13(18-12)20(3)4)15-9-5-7-10(8-6-9)23(14,21)22/h5-8H,1-4H3,(H2,14,21,22)(H,15,16,17,18) |
| InChIKey | OMCXNNLRKQYPQX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |