C16H21F3N6 — CID 141423014
2-N,2-N-diethyl-4-N,4-N-dimethyl-6-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 141423014) has the molecular formula C16H21F3N6 and a molecular weight of 354.38 g/mol. Its IUPAC name is 2-N,2-N-diethyl-4-N,4-N-dimethyl-6-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-diethyl-4-N,4-N-dimethyl-6-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 141423014 |
| Molecular Formula | C16H21F3N6 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-N,2-N-diethyl-4-N,4-N-dimethyl-6-N-[4-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(Nc2ccc(C(F)(F)F)cc2)nc(N(C)C)n1 |
| InChI | InChI=1S/C16H21F3N6/c1-5-25(6-2)15-22-13(21-14(23-15)24(3)4)20-12-9-7-11(8-10-12)16(17,18)19/h7-10H,5-6H2,1-4H3,(H,20,21,22,23) |
| InChIKey | VZABMVWUCFBQAM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |