C21H18N4O3S — CID 174726378
4-[[4-(2-methoxyphenyl)phthalazin-1-yl]amino]benzenesulfonamide (PubChem CID 174726378) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is 4-[[4-(2-methoxyphenyl)phthalazin-1-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4-(2-methoxyphenyl)phthalazin-1-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 174726378 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 4-[[4-(2-methoxyphenyl)phthalazin-1-yl]amino]benzenesulfonamide |
| SMILES | COc1ccccc1-c1nnc(Nc2ccc(S(N)(=O)=O)cc2)c2ccccc12 |
| InChI | InChI=1S/C21H18N4O3S/c1-28-19-9-5-4-8-18(19)20-16-6-2-3-7-17(16)21(25-24-20)23-14-10-12-15(13-11-14)29(22,26)27/h2-13H,1H3,(H,23,25)(H2,22,26,27) |
| InChIKey | SJBKYODMNLFLRL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |