C18H16N6O3S — CID 174597300
3-[[6-(2-methoxyphenyl)-7H-purin-2-yl]amino]benzenesulfonamide (PubChem CID 174597300) has the molecular formula C18H16N6O3S and a molecular weight of 396.43 g/mol. Its IUPAC name is 3-[[6-(2-methoxyphenyl)-7H-purin-2-yl]amino]benzenesulfonamide.
| Compound Name | 3-[[6-(2-methoxyphenyl)-7H-purin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 174597300 |
| Molecular Formula | C18H16N6O3S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 3-[[6-(2-methoxyphenyl)-7H-purin-2-yl]amino]benzenesulfonamide |
| SMILES | COc1ccccc1-c1nc(Nc2cccc(S(N)(=O)=O)c2)nc2nc[nH]c12 |
| InChI | InChI=1S/C18H16N6O3S/c1-27-14-8-3-2-7-13(14)15-16-17(21-10-20-16)24-18(23-15)22-11-5-4-6-12(9-11)28(19,25)26/h2-10H,1H3,(H2,19,25,26)(H2,20,21,22,23,24) |
| InChIKey | ZTVARJCHHARZEX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |