C19H18N4O2S — CID 11405920
3-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-ylamino)benzenesulfonamide (PubChem CID 11405920) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 3-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-ylamino)benzenesulfonamide.
| Compound Name | 3-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 11405920 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-(3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-ylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(Nc2ncc3c(n2)-c2ccccc2CCC3)c1 |
| InChI | InChI=1S/C19H18N4O2S/c20-26(24,25)16-9-4-8-15(11-16)22-19-21-12-14-7-3-6-13-5-1-2-10-17(13)18(14)23-19/h1-2,4-5,8-12H,3,6-7H2,(H2,20,24,25)(H,21,22,23) |
| InChIKey | XUEJPYCRXITLCD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |