C18H17N7O2S — CID 164577972
4-[[6-[3-(aminomethyl)phenyl]-7H-purin-2-yl]amino]benzenesulfonamide (PubChem CID 164577972) has the molecular formula C18H17N7O2S and a molecular weight of 395.45 g/mol. Its IUPAC name is 4-[[6-[3-(aminomethyl)phenyl]-7H-purin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[6-[3-(aminomethyl)phenyl]-7H-purin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 164577972 |
| Molecular Formula | C18H17N7O2S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 4-[[6-[3-(aminomethyl)phenyl]-7H-purin-2-yl]amino]benzenesulfonamide |
| SMILES | NCc1cccc(-c2nc(Nc3ccc(S(N)(=O)=O)cc3)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C18H17N7O2S/c19-9-11-2-1-3-12(8-11)15-16-17(22-10-21-16)25-18(24-15)23-13-4-6-14(7-5-13)28(20,26)27/h1-8,10H,9,19H2,(H2,20,26,27)(H2,21,22,23,24,25) |
| InChIKey | YMPPLNLHLKNBQC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 152.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |