C13H14N6 — CID 39756778
6-[3-(2-aminoethyl)phenyl]-7H-purin-2-amine (PubChem CID 39756778) has the molecular formula C13H14N6 and a molecular weight of 254.30 g/mol. Its IUPAC name is 6-[3-(2-aminoethyl)phenyl]-7H-purin-2-amine.
| Compound Name | 6-[3-(2-aminoethyl)phenyl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 39756778 |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 6-[3-(2-aminoethyl)phenyl]-7H-purin-2-amine |
| SMILES | NCCc1cccc(-c2nc(N)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C13H14N6/c14-5-4-8-2-1-3-9(6-8)10-11-12(17-7-16-11)19-13(15)18-10/h1-3,6-7H,4-5,14H2,(H3,15,16,17,18,19) |
| InChIKey | VMFLZSBKZYZTLO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |