C6H7N5O — CID 11593490
(2-amino-7H-purin-6-yl)methanol (PubChem CID 11593490) has the molecular formula C6H7N5O and a molecular weight of 165.16 g/mol. Its IUPAC name is (2-amino-7H-purin-6-yl)methanol.
| Compound Name | (2-amino-7H-purin-6-yl)methanol |
|---|---|
| PubChem CID | 11593490 |
| Molecular Formula | C6H7N5O |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | (2-amino-7H-purin-6-yl)methanol |
| SMILES | Nc1nc(CO)c2[nH]cnc2n1 |
| InChI | InChI=1S/C6H7N5O/c7-6-10-3(1-12)4-5(11-6)9-2-8-4/h2,12H,1H2,(H3,7,8,9,10,11) |
| InChIKey | PMRMMZHQJHUHQS-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |