C8H11N5O2S — CID 114788446
3-[(2-amino-7H-purin-6-yl)sulfanyl]propane-1,2-diol (PubChem CID 114788446) has the molecular formula C8H11N5O2S and a molecular weight of 241.28 g/mol. Its IUPAC name is 3-[(2-amino-7H-purin-6-yl)sulfanyl]propane-1,2-diol.
| Compound Name | 3-[(2-amino-7H-purin-6-yl)sulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 114788446 |
| Molecular Formula | C8H11N5O2S |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3-[(2-amino-7H-purin-6-yl)sulfanyl]propane-1,2-diol |
| SMILES | Nc1nc(SCC(O)CO)c2[nH]cnc2n1 |
| InChI | InChI=1S/C8H11N5O2S/c9-8-12-6-5(10-3-11-6)7(13-8)16-2-4(15)1-14/h3-4,14-15H,1-2H2,(H3,9,10,11,12,13) |
| InChIKey | XRINDMMDLKDNRH-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |