C18H24N6O2S — CID 166565269
6-[2-(3,4-dimethoxyanilino)pentylsulfanyl]-7H-purin-2-amine (PubChem CID 166565269) has the molecular formula C18H24N6O2S and a molecular weight of 388.50 g/mol. Its IUPAC name is 6-[2-(3,4-dimethoxyanilino)pentylsulfanyl]-7H-purin-2-amine.
| Compound Name | 6-[2-(3,4-dimethoxyanilino)pentylsulfanyl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 166565269 |
| Molecular Formula | C18H24N6O2S |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 6-[2-(3,4-dimethoxyanilino)pentylsulfanyl]-7H-purin-2-amine |
| SMILES | CCCC(CSc1nc(N)nc2nc[nH]c12)Nc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H24N6O2S/c1-4-5-12(22-11-6-7-13(25-2)14(8-11)26-3)9-27-17-15-16(21-10-20-15)23-18(19)24-17/h6-8,10,12,22H,4-5,9H2,1-3H3,(H3,19,20,21,23,24) |
| InChIKey | DLIHTPVYAFQPNR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|