C13H15N7O2S — CID 167288270
6-[2-[(2-amino-7H-purin-6-yl)sulfanyl]ethylamino]-4-methoxypyridin-3-ol (PubChem CID 167288270) has the molecular formula C13H15N7O2S and a molecular weight of 333.38 g/mol. Its IUPAC name is 6-[2-[(2-amino-7H-purin-6-yl)sulfanyl]ethylamino]-4-methoxypyridin-3-ol.
| Compound Name | 6-[2-[(2-amino-7H-purin-6-yl)sulfanyl]ethylamino]-4-methoxypyridin-3-ol |
|---|---|
| PubChem CID | 167288270 |
| Molecular Formula | C13H15N7O2S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 6-[2-[(2-amino-7H-purin-6-yl)sulfanyl]ethylamino]-4-methoxypyridin-3-ol |
| SMILES | COc1cc(NCCSc2nc(N)nc3nc[nH]c23)ncc1O |
| InChI | InChI=1S/C13H15N7O2S/c1-22-8-4-9(16-5-7(8)21)15-2-3-23-12-10-11(18-6-17-10)19-13(14)20-12/h4-6,21H,2-3H2,1H3,(H,15,16)(H3,14,17,18,19,20) |
| InChIKey | SBPSZRBQTYPAFC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|