C12H14N8OS — CID 167288010
6-[2-[(4-methoxypyrimidin-2-yl)amino]ethylsulfanyl]-7H-purin-2-amine (PubChem CID 167288010) has the molecular formula C12H14N8OS and a molecular weight of 318.37 g/mol. Its IUPAC name is 6-[2-[(4-methoxypyrimidin-2-yl)amino]ethylsulfanyl]-7H-purin-2-amine.
| Compound Name | 6-[2-[(4-methoxypyrimidin-2-yl)amino]ethylsulfanyl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 167288010 |
| Molecular Formula | C12H14N8OS |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 6-[2-[(4-methoxypyrimidin-2-yl)amino]ethylsulfanyl]-7H-purin-2-amine |
| SMILES | COc1ccnc(NCCSc2nc(N)nc3nc[nH]c23)n1 |
| InChI | InChI=1S/C12H14N8OS/c1-21-7-2-3-14-12(18-7)15-4-5-22-10-8-9(17-6-16-8)19-11(13)20-10/h2-3,6H,4-5H2,1H3,(H,14,15,18)(H3,13,16,17,19,20) |
| InChIKey | PVGGZPMIJUVSHX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 127.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|