C19H18N8O2S — CID 167287924
(2S)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(4-phenoxypyrimidin-2-yl)butanamide (PubChem CID 167287924) has the molecular formula C19H18N8O2S and a molecular weight of 422.47 g/mol. Its IUPAC name is (2S)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(4-phenoxypyrimidin-2-yl)butanamide.
| Compound Name | (2S)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(4-phenoxypyrimidin-2-yl)butanamide |
|---|---|
| PubChem CID | 167287924 |
| Molecular Formula | C19H18N8O2S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (2S)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(4-phenoxypyrimidin-2-yl)butanamide |
| SMILES | CC[C@H](Sc1nc(N)nc2nc[nH]c12)C(=O)Nc1nccc(Oc2ccccc2)n1 |
| InChI | InChI=1S/C19H18N8O2S/c1-2-12(30-17-14-15(23-10-22-14)25-18(20)27-17)16(28)26-19-21-9-8-13(24-19)29-11-6-4-3-5-7-11/h3-10,12H,2H2,1H3,(H,21,24,26,28)(H3,20,22,23,25,27)/t12-/m0/s1 |
| InChIKey | FUMVSIKAMJRFSO-LBPRGKRZSA-N |
| XLogP | 3.03 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |