C14H13F3N8OS — CID 166565257
(2S)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-[4-(trifluoromethyl)pyrimidin-2-yl]butanamide (PubChem CID 166565257) has the molecular formula C14H13F3N8OS and a molecular weight of 398.37 g/mol. Its IUPAC name is (2S)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-[4-(trifluoromethyl)pyrimidin-2-yl]butanamide.
| Compound Name | (2S)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-[4-(trifluoromethyl)pyrimidin-2-yl]butanamide |
|---|---|
| PubChem CID | 166565257 |
| Molecular Formula | C14H13F3N8OS |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (2S)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-[4-(trifluoromethyl)pyrimidin-2-yl]butanamide |
| SMILES | CC[C@H](Sc1nc(N)nc2nc[nH]c12)C(=O)Nc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H13F3N8OS/c1-2-6(27-11-8-9(21-5-20-8)23-12(18)25-11)10(26)24-13-19-4-3-7(22-13)14(15,16)17/h3-6H,2H2,1H3,(H,19,22,24,26)(H3,18,20,21,23,25)/t6-/m0/s1 |
| InChIKey | IEILVXKOHXEFCG-LURJTMIESA-N |
| XLogP | 2.25 |
| TPSA | 135.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |