C13H14N8O2S — CID 167288382
(2R)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(5-hydroxypyrimidin-2-yl)butanamide (PubChem CID 167288382) has the molecular formula C13H14N8O2S and a molecular weight of 346.38 g/mol. Its IUPAC name is (2R)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(5-hydroxypyrimidin-2-yl)butanamide.
| Compound Name | (2R)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(5-hydroxypyrimidin-2-yl)butanamide |
|---|---|
| PubChem CID | 167288382 |
| Molecular Formula | C13H14N8O2S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (2R)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(5-hydroxypyrimidin-2-yl)butanamide |
| SMILES | CC[C@@H](Sc1nc(N)nc2nc[nH]c12)C(=O)Nc1ncc(O)cn1 |
| InChI | InChI=1S/C13H14N8O2S/c1-2-7(10(23)20-13-15-3-6(22)4-16-13)24-11-8-9(18-5-17-8)19-12(14)21-11/h3-5,7,22H,2H2,1H3,(H,15,16,20,23)(H3,14,17,18,19,21)/t7-/m1/s1 |
| InChIKey | LHNFKXAUZCQCLV-SSDOTTSWSA-N |
| XLogP | 0.94 |
| TPSA | 155.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |