C13H14N8O2S — CID 167288380
(2R)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(6-oxo-1H-pyrimidin-2-yl)butanamide (PubChem CID 167288380) has the molecular formula C13H14N8O2S and a molecular weight of 346.38 g/mol. Its IUPAC name is (2R)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(6-oxo-1H-pyrimidin-2-yl)butanamide.
| Compound Name | (2R)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(6-oxo-1H-pyrimidin-2-yl)butanamide |
|---|---|
| PubChem CID | 167288380 |
| Molecular Formula | C13H14N8O2S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | (2R)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(6-oxo-1H-pyrimidin-2-yl)butanamide |
| SMILES | CC[C@@H](Sc1nc(N)nc2nc[nH]c12)C(=O)Nc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C13H14N8O2S/c1-2-6(10(23)20-13-15-4-3-7(22)18-13)24-11-8-9(17-5-16-8)19-12(14)21-11/h3-6H,2H2,1H3,(H3,14,16,17,19,21)(H2,15,18,20,22,23)/t6-/m1/s1 |
| InChIKey | UIRAAPUXAJQTPX-ZCFIWIBFSA-N |
| XLogP | 0.53 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |