C15H15N9OS — CID 167288424
(2R)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(2H-benzotriazol-5-yl)butanamide (PubChem CID 167288424) has the molecular formula C15H15N9OS and a molecular weight of 369.41 g/mol. Its IUPAC name is (2R)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(2H-benzotriazol-5-yl)butanamide.
| Compound Name | (2R)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(2H-benzotriazol-5-yl)butanamide |
|---|---|
| PubChem CID | 167288424 |
| Molecular Formula | C15H15N9OS |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (2R)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(2H-benzotriazol-5-yl)butanamide |
| SMILES | CCC(Sc1nc(N)nc2nc[nH]c12)C(=O)Nc1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C15H15N9OS/c1-2-10(26-14-11-12(18-6-17-11)20-15(16)21-14)13(25)19-7-3-4-8-9(5-7)23-24-22-8/h3-6,10H,2H2,1H3,(H,19,25)(H,22,23,24)(H3,16,17,18,20,21) |
| InChIKey | ZSNMVZKRGGGVFZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 151.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |