C20H24N6O3S — CID 166565064
(2S)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-2-cyclohexyl-N-(4-hydroxy-3-methoxyphenyl)acetamide (PubChem CID 166565064) has the molecular formula C20H24N6O3S and a molecular weight of 428.52 g/mol. Its IUPAC name is (2S)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-2-cyclohexyl-N-(4-hydroxy-3-methoxyphenyl)acetamide.
| Compound Name | (2S)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-2-cyclohexyl-N-(4-hydroxy-3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 166565064 |
| Molecular Formula | C20H24N6O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (2S)-2-[(2-amino-7H-purin-6-yl)sulfanyl]-2-cyclohexyl-N-(4-hydroxy-3-methoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)[C@@H](Sc2nc(N)nc3nc[nH]c23)C2CCCCC2)ccc1O |
| InChI | InChI=1S/C20H24N6O3S/c1-29-14-9-12(7-8-13(14)27)24-18(28)16(11-5-3-2-4-6-11)30-19-15-17(23-10-22-15)25-20(21)26-19/h7-11,16,27H,2-6H2,1H3,(H,24,28)(H3,21,22,23,25,26)/t16-/m0/s1 |
| InChIKey | VGGUUAXLRJJPHT-INIZCTEOSA-N |
| XLogP | 3.33 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|