C17H20N6O2S — CID 166565162
6-[[1-(3,4-dimethoxyanilino)cyclopropyl]methylsulfanyl]-7H-purin-2-amine (PubChem CID 166565162) has the molecular formula C17H20N6O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is 6-[[1-(3,4-dimethoxyanilino)cyclopropyl]methylsulfanyl]-7H-purin-2-amine.
| Compound Name | 6-[[1-(3,4-dimethoxyanilino)cyclopropyl]methylsulfanyl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 166565162 |
| Molecular Formula | C17H20N6O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 6-[[1-(3,4-dimethoxyanilino)cyclopropyl]methylsulfanyl]-7H-purin-2-amine |
| SMILES | COc1ccc(NC2(CSc3nc(N)nc4nc[nH]c34)CC2)cc1OC |
| InChI | InChI=1S/C17H20N6O2S/c1-24-11-4-3-10(7-12(11)25-2)23-17(5-6-17)8-26-15-13-14(20-9-19-13)21-16(18)22-15/h3-4,7,9,23H,5-6,8H2,1-2H3,(H3,18,19,20,21,22) |
| InChIKey | TYCHXZDERKHZAC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|