C16H18N6O3S — CID 167287889
2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(3-ethoxy-4-methoxyphenyl)acetamide (PubChem CID 167287889) has the molecular formula C16H18N6O3S and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(3-ethoxy-4-methoxyphenyl)acetamide.
| Compound Name | 2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(3-ethoxy-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 167287889 |
| Molecular Formula | C16H18N6O3S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-[(2-amino-7H-purin-6-yl)sulfanyl]-N-(3-ethoxy-4-methoxyphenyl)acetamide |
| SMILES | CCOc1cc(NC(=O)CSc2nc(N)nc3nc[nH]c23)ccc1OC |
| InChI | InChI=1S/C16H18N6O3S/c1-3-25-11-6-9(4-5-10(11)24-2)20-12(23)7-26-15-13-14(19-8-18-13)21-16(17)22-15/h4-6,8H,3,7H2,1-2H3,(H,20,23)(H3,17,18,19,21,22) |
| InChIKey | IQOAXHMAIVGPTE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |