C16H16N6O4S — CID 167288017
methyl 5-[[2-[(2-amino-7H-purin-6-yl)sulfanyl]acetyl]amino]-2-methoxybenzoate (PubChem CID 167288017) has the molecular formula C16H16N6O4S and a molecular weight of 388.41 g/mol. Its IUPAC name is methyl 5-[[2-[(2-amino-7H-purin-6-yl)sulfanyl]acetyl]amino]-2-methoxybenzoate.
| Compound Name | methyl 5-[[2-[(2-amino-7H-purin-6-yl)sulfanyl]acetyl]amino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 167288017 |
| Molecular Formula | C16H16N6O4S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | methyl 5-[[2-[(2-amino-7H-purin-6-yl)sulfanyl]acetyl]amino]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(NC(=O)CSc2nc(N)nc3nc[nH]c23)ccc1OC |
| InChI | InChI=1S/C16H16N6O4S/c1-25-10-4-3-8(5-9(10)15(24)26-2)20-11(23)6-27-14-12-13(19-7-18-12)21-16(17)22-14/h3-5,7H,6H2,1-2H3,(H,20,23)(H3,17,18,19,21,22) |
| InChIKey | XGKDOOOEQJHKSD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |