C13H13N7O2S — CID 167288082
N-(4-amino-2-hydroxyphenyl)-2-[(2-amino-7H-purin-6-yl)sulfanyl]acetamide (PubChem CID 167288082) has the molecular formula C13H13N7O2S and a molecular weight of 331.36 g/mol. Its IUPAC name is N-(4-amino-2-hydroxyphenyl)-2-[(2-amino-7H-purin-6-yl)sulfanyl]acetamide.
| Compound Name | N-(4-amino-2-hydroxyphenyl)-2-[(2-amino-7H-purin-6-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 167288082 |
| Molecular Formula | C13H13N7O2S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-(4-amino-2-hydroxyphenyl)-2-[(2-amino-7H-purin-6-yl)sulfanyl]acetamide |
| SMILES | Nc1ccc(NC(=O)CSc2nc(N)nc3nc[nH]c23)c(O)c1 |
| InChI | InChI=1S/C13H13N7O2S/c14-6-1-2-7(8(21)3-6)18-9(22)4-23-12-10-11(17-5-16-10)19-13(15)20-12/h1-3,5,21H,4,14H2,(H,18,22)(H3,15,16,17,19,20) |
| InChIKey | OIHLDABSVICOQF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 155.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|