C17H18N6O4S — CID 166565196
5-[[2-[(2-amino-7H-purin-6-yl)sulfanyl]-2-methylbutanoyl]amino]-2-hydroxybenzoic acid (PubChem CID 166565196) has the molecular formula C17H18N6O4S and a molecular weight of 402.44 g/mol. Its IUPAC name is 5-[[2-[(2-amino-7H-purin-6-yl)sulfanyl]-2-methylbutanoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[2-[(2-amino-7H-purin-6-yl)sulfanyl]-2-methylbutanoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 166565196 |
| Molecular Formula | C17H18N6O4S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 5-[[2-[(2-amino-7H-purin-6-yl)sulfanyl]-2-methylbutanoyl]amino]-2-hydroxybenzoic acid |
| SMILES | CCC(C)(Sc1nc(N)nc2nc[nH]c12)C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H18N6O4S/c1-3-17(2,28-13-11-12(20-7-19-11)22-16(18)23-13)15(27)21-8-4-5-10(24)9(6-8)14(25)26/h4-7,24H,3H2,1-2H3,(H,21,27)(H,25,26)(H3,18,19,20,22,23) |
| InChIKey | NXENPCAKGXPBGY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 167.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|