C16H18N6O4S — CID 166565164
3-[(2-amino-7H-purin-6-yl)sulfanyl]-2-(3,4-dimethoxyanilino)propanoic acid (PubChem CID 166565164) has the molecular formula C16H18N6O4S and a molecular weight of 390.43 g/mol. Its IUPAC name is 3-[(2-amino-7H-purin-6-yl)sulfanyl]-2-(3,4-dimethoxyanilino)propanoic acid.
| Compound Name | 3-[(2-amino-7H-purin-6-yl)sulfanyl]-2-(3,4-dimethoxyanilino)propanoic acid |
|---|---|
| PubChem CID | 166565164 |
| Molecular Formula | C16H18N6O4S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 3-[(2-amino-7H-purin-6-yl)sulfanyl]-2-(3,4-dimethoxyanilino)propanoic acid |
| SMILES | COc1ccc(NC(CSc2nc(N)nc3nc[nH]c23)C(=O)O)cc1OC |
| InChI | InChI=1S/C16H18N6O4S/c1-25-10-4-3-8(5-11(10)26-2)20-9(15(23)24)6-27-14-12-13(19-7-18-12)21-16(17)22-14/h3-5,7,9,20H,6H2,1-2H3,(H,23,24)(H3,17,18,19,21,22) |
| InChIKey | ZEVUVDYYDQETHU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 148.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|