C13H15N7OS — CID 166565302
6-[2-[(4-methoxy-2-pyridinyl)amino]ethylsulfanyl]-7H-purin-2-amine (PubChem CID 166565302) has the molecular formula C13H15N7OS and a molecular weight of 317.38 g/mol. Its IUPAC name is 6-[2-[(4-methoxy-2-pyridinyl)amino]ethylsulfanyl]-7H-purin-2-amine.
| Compound Name | 6-[2-[(4-methoxy-2-pyridinyl)amino]ethylsulfanyl]-7H-purin-2-amine |
|---|---|
| PubChem CID | 166565302 |
| Molecular Formula | C13H15N7OS |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 6-[2-[(4-methoxy-2-pyridinyl)amino]ethylsulfanyl]-7H-purin-2-amine |
| SMILES | COc1ccnc(NCCSc2nc(N)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C13H15N7OS/c1-21-8-2-3-15-9(6-8)16-4-5-22-12-10-11(18-7-17-10)19-13(14)20-12/h2-3,6-7H,4-5H2,1H3,(H,15,16)(H3,14,17,18,19,20) |
| InChIKey | XLPHFZIIBUHWHJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|