C11H10N6O — CID 114052406
6-(2-methoxy-4-pyridinyl)-7H-purin-2-amine (PubChem CID 114052406) has the molecular formula C11H10N6O and a molecular weight of 242.24 g/mol. Its IUPAC name is 6-(2-methoxy-4-pyridinyl)-7H-purin-2-amine.
| Compound Name | 6-(2-methoxy-4-pyridinyl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 114052406 |
| Molecular Formula | C11H10N6O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 6-(2-methoxy-4-pyridinyl)-7H-purin-2-amine |
| SMILES | COc1cc(-c2nc(N)nc3nc[nH]c23)ccn1 |
| InChI | InChI=1S/C11H10N6O/c1-18-7-4-6(2-3-13-7)8-9-10(15-5-14-9)17-11(12)16-8/h2-5H,1H3,(H3,12,14,15,16,17) |
| InChIKey | OULCVYFYLIHCIC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |