C8H8F3N5O — CID 114787836
6-(1,1,1-trifluoropropan-2-yloxy)-7H-purin-2-amine (PubChem CID 114787836) has the molecular formula C8H8F3N5O and a molecular weight of 247.18 g/mol. Its IUPAC name is 6-(1,1,1-trifluoropropan-2-yloxy)-7H-purin-2-amine.
| Compound Name | 6-(1,1,1-trifluoropropan-2-yloxy)-7H-purin-2-amine |
|---|---|
| PubChem CID | 114787836 |
| Molecular Formula | C8H8F3N5O |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 6-(1,1,1-trifluoropropan-2-yloxy)-7H-purin-2-amine |
| SMILES | CC(Oc1nc(N)nc2nc[nH]c12)C(F)(F)F |
| InChI | InChI=1S/C8H8F3N5O/c1-3(8(9,10)11)17-6-4-5(14-2-13-4)15-7(12)16-6/h2-3H,1H3,(H3,12,13,14,15,16) |
| InChIKey | CXRSIEJDNNGZBY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |