C13H13N5O — CID 114787154
6-(2,3-dimethylphenoxy)-7H-purin-2-amine (PubChem CID 114787154) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 6-(2,3-dimethylphenoxy)-7H-purin-2-amine.
| Compound Name | 6-(2,3-dimethylphenoxy)-7H-purin-2-amine |
|---|---|
| PubChem CID | 114787154 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 6-(2,3-dimethylphenoxy)-7H-purin-2-amine |
| SMILES | Cc1cccc(Oc2nc(N)nc3nc[nH]c23)c1C |
| InChI | InChI=1S/C13H13N5O/c1-7-4-3-5-9(8(7)2)19-12-10-11(16-6-15-10)17-13(14)18-12/h3-6H,1-2H3,(H3,14,15,16,17,18) |
| InChIKey | UJZIVDSZCOUAKJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |