C13H13N5O2 — CID 91991251
2-[2-[(2-amino-7H-purin-6-yl)oxy]phenyl]ethanol (PubChem CID 91991251) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2-[2-[(2-amino-7H-purin-6-yl)oxy]phenyl]ethanol.
| Compound Name | 2-[2-[(2-amino-7H-purin-6-yl)oxy]phenyl]ethanol |
|---|---|
| PubChem CID | 91991251 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-[2-[(2-amino-7H-purin-6-yl)oxy]phenyl]ethanol |
| SMILES | Nc1nc(Oc2ccccc2CCO)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H13N5O2/c14-13-17-11-10(15-7-16-11)12(18-13)20-9-4-2-1-3-8(9)5-6-19/h1-4,7,19H,5-6H2,(H3,14,15,16,17,18) |
| InChIKey | PRXSLOQPBYZGRQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |