C12H12N6O — CID 5329517
6-[(3-aminophenyl)methoxy]-7H-purin-2-amine (PubChem CID 5329517) has the molecular formula C12H12N6O and a molecular weight of 256.27 g/mol. Its IUPAC name is 6-[(3-aminophenyl)methoxy]-7H-purin-2-amine.
| Compound Name | 6-[(3-aminophenyl)methoxy]-7H-purin-2-amine |
|---|---|
| PubChem CID | 5329517 |
| Molecular Formula | C12H12N6O |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 6-[(3-aminophenyl)methoxy]-7H-purin-2-amine |
| SMILES | Nc1cccc(COc2nc(N)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C12H12N6O/c13-8-3-1-2-7(4-8)5-19-11-9-10(16-6-15-9)17-12(14)18-11/h1-4,6H,5,13H2,(H3,14,15,16,17,18) |
| InChIKey | QCEFDVCKQLVMCW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|