C15H16N6O2 — CID 71462400
N-[[3-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]acetamide (PubChem CID 71462400) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[[3-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]acetamide.
| Compound Name | N-[[3-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 71462400 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[[3-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cccc(COc2nc(N)nc3nc[nH]c23)c1 |
| InChI | InChI=1S/C15H16N6O2/c1-9(22)17-6-10-3-2-4-11(5-10)7-23-14-12-13(19-8-18-12)20-15(16)21-14/h2-5,8H,6-7H2,1H3,(H,17,22)(H3,16,18,19,20,21) |
| InChIKey | AZYZDBZLSSRIBX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |