C23H31N7O4S2 — CID 123949645
N'-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-N-[2-(2-methoxyethyldisulfanyl)ethyl]pentanediamide (PubChem CID 123949645) has the molecular formula C23H31N7O4S2 and a molecular weight of 533.68 g/mol. Its IUPAC name is N'-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-N-[2-(2-methoxyethyldisulfanyl)ethyl]pentanediamide.
| Compound Name | N'-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-N-[2-(2-methoxyethyldisulfanyl)ethyl]pentanediamide |
|---|---|
| PubChem CID | 123949645 |
| Molecular Formula | C23H31N7O4S2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | N'-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-N-[2-(2-methoxyethyldisulfanyl)ethyl]pentanediamide |
| SMILES | COCCSSCCNC(=O)CCCC(=O)NCc1ccc(COc2nc(N)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C23H31N7O4S2/c1-33-10-12-36-35-11-9-25-18(31)3-2-4-19(32)26-13-16-5-7-17(8-6-16)14-34-22-20-21(28-15-27-20)29-23(24)30-22/h5-8,15H,2-4,9-14H2,1H3,(H,25,31)(H,26,32)(H3,24,27,28,29,30) |
| InChIKey | UAECZZDTPNLZMT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 157.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|