C18H20N6O3 — CID 91133793
N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-5-oxopentanamide (PubChem CID 91133793) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-5-oxopentanamide.
| Compound Name | N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-5-oxopentanamide |
|---|---|
| PubChem CID | 91133793 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]methyl]-5-oxopentanamide |
| SMILES | Nc1nc(OCc2ccc(CNC(=O)CCCC=O)cc2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C18H20N6O3/c19-18-23-16-15(21-11-22-16)17(24-18)27-10-13-6-4-12(5-7-13)9-20-14(26)3-1-2-8-25/h4-8,11H,1-3,9-10H2,(H,20,26)(H3,19,21,22,23,24) |
| InChIKey | BRDMPESNSXUXNT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|