C24H34N6O5 — CID 149184578
6-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-1-[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]hexan-3-one (PubChem CID 149184578) has the molecular formula C24H34N6O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is 6-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-1-[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]hexan-3-one.
| Compound Name | 6-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-1-[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]hexan-3-one |
|---|---|
| PubChem CID | 149184578 |
| Molecular Formula | C24H34N6O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 6-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-1-[4-[(2-amino-7H-purin-6-yl)oxymethyl]phenyl]hexan-3-one |
| SMILES | NCCOCCOCCOCCCC(=O)CCc1ccc(COc2nc(N)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C24H34N6O5/c25-9-11-33-13-15-34-14-12-32-10-1-2-20(31)8-7-18-3-5-19(6-4-18)16-35-23-21-22(28-17-27-21)29-24(26)30-23/h3-6,17H,1-2,7-16,25H2,(H3,26,27,28,29,30) |
| InChIKey | XBPWPDRRJUXTKE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 160.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|