C11H22N8O2 — CID 175436087
2-[2-(2-aminoethoxy)ethoxy]ethanamine;7H-purine-2,6-diamine (PubChem CID 175436087) has the molecular formula C11H22N8O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-[2-(2-aminoethoxy)ethoxy]ethanamine;7H-purine-2,6-diamine.
| Compound Name | 2-[2-(2-aminoethoxy)ethoxy]ethanamine;7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 175436087 |
| Molecular Formula | C11H22N8O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[2-(2-aminoethoxy)ethoxy]ethanamine;7H-purine-2,6-diamine |
| SMILES | NCCOCCOCCN.Nc1nc(N)c2[nH]cnc2n1 |
| InChI | InChI=1S/C6H16N2O2.C5H6N6/c7-1-3-9-5-6-10-4-2-8;6-3-2-4(9-1-8-2)11-5(7)10-3/h1-8H2;1H,(H5,6,7,8,9,10,11) |
| InChIKey | PKSLAKVFWUCFBZ-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|