C7H7F2N5O — CID 114787974
6-(2,2-difluoroethoxy)-7H-purin-2-amine (PubChem CID 114787974) has the molecular formula C7H7F2N5O and a molecular weight of 215.16 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)-7H-purin-2-amine.
| Compound Name | 6-(2,2-difluoroethoxy)-7H-purin-2-amine |
|---|---|
| PubChem CID | 114787974 |
| Molecular Formula | C7H7F2N5O |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 6-(2,2-difluoroethoxy)-7H-purin-2-amine |
| SMILES | Nc1nc(OCC(F)F)c2[nH]cnc2n1 |
| InChI | InChI=1S/C7H7F2N5O/c8-3(9)1-15-6-4-5(12-2-11-4)13-7(10)14-6/h2-3H,1H2,(H3,10,11,12,13,14) |
| InChIKey | ZIACRPVAIDKXIM-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |