C9H14N6 — CID 174749198
6-(1-amino-2-methylpropyl)-7H-purin-2-amine (PubChem CID 174749198) has the molecular formula C9H14N6 and a molecular weight of 206.25 g/mol. Its IUPAC name is 6-(1-amino-2-methylpropyl)-7H-purin-2-amine.
| Compound Name | 6-(1-amino-2-methylpropyl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 174749198 |
| Molecular Formula | C9H14N6 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 6-(1-amino-2-methylpropyl)-7H-purin-2-amine |
| SMILES | CC(C)C(N)c1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C9H14N6/c1-4(2)5(10)6-7-8(13-3-12-7)15-9(11)14-6/h3-5H,10H2,1-2H3,(H3,11,12,13,14,15) |
| InChIKey | HQKYBFBBKHHJIZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |