C12H10ClN5O — CID 5329518
6-[(3-chlorophenyl)methoxy]-7H-purin-2-amine (PubChem CID 5329518) has the molecular formula C12H10ClN5O and a molecular weight of 275.70 g/mol. Its IUPAC name is 6-[(3-chlorophenyl)methoxy]-7H-purin-2-amine.
| Compound Name | 6-[(3-chlorophenyl)methoxy]-7H-purin-2-amine |
|---|---|
| PubChem CID | 5329518 |
| Molecular Formula | C12H10ClN5O |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 6-[(3-chlorophenyl)methoxy]-7H-purin-2-amine |
| SMILES | Nc1nc(OCc2cccc(Cl)c2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H10ClN5O/c13-8-3-1-2-7(4-8)5-19-11-9-10(16-6-15-9)17-12(14)18-11/h1-4,6H,5H2,(H3,14,15,16,17,18) |
| InChIKey | VUQKCWOEARWBLF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |