C14H12ClN3OS — CID 103332823
4-[(3-chlorophenyl)methoxy]-6-methylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 103332823) has the molecular formula C14H12ClN3OS and a molecular weight of 305.79 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methoxy]-6-methylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-[(3-chlorophenyl)methoxy]-6-methylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 103332823 |
| Molecular Formula | C14H12ClN3OS |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 4-[(3-chlorophenyl)methoxy]-6-methylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1cc2c(OCc3cccc(Cl)c3)nc(N)nc2s1 |
| InChI | InChI=1S/C14H12ClN3OS/c1-8-5-11-12(17-14(16)18-13(11)20-8)19-7-9-3-2-4-10(15)6-9/h2-6H,7H2,1H3,(H2,16,17,18) |
| InChIKey | OEVNRISMCBMYMV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |