C12H8Cl2N4O — CID 86188206
2-chloro-6-[(4-chlorophenyl)methoxy]-7H-purine (PubChem CID 86188206) has the molecular formula C12H8Cl2N4O and a molecular weight of 295.13 g/mol. Its IUPAC name is 2-chloro-6-[(4-chlorophenyl)methoxy]-7H-purine.
| Compound Name | 2-chloro-6-[(4-chlorophenyl)methoxy]-7H-purine |
|---|---|
| PubChem CID | 86188206 |
| Molecular Formula | C12H8Cl2N4O |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 2-chloro-6-[(4-chlorophenyl)methoxy]-7H-purine |
| SMILES | Clc1ccc(COc2nc(Cl)nc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C12H8Cl2N4O/c13-8-3-1-7(2-4-8)5-19-11-9-10(16-6-15-9)17-12(14)18-11/h1-4,6H,5H2,(H,15,16,17,18) |
| InChIKey | CCONJUBMINLVPM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |