C8H11N5O2 — CID 20566205
2-[(6-amino-7H-purin-2-yl)methoxy]ethanol (PubChem CID 20566205) has the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. Its IUPAC name is 2-[(6-amino-7H-purin-2-yl)methoxy]ethanol.
| Compound Name | 2-[(6-amino-7H-purin-2-yl)methoxy]ethanol |
|---|---|
| PubChem CID | 20566205 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-[(6-amino-7H-purin-2-yl)methoxy]ethanol |
| SMILES | Nc1nc(COCCO)nc2nc[nH]c12 |
| InChI | InChI=1S/C8H11N5O2/c9-7-6-8(11-4-10-6)13-5(12-7)3-15-2-1-14/h4,14H,1-3H2,(H3,9,10,11,12,13) |
| InChIKey | ROLQUXWMUOQSTR-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|