C14H15N5O2 — CID 155490354
1-(6-amino-7H-purin-2-yl)-3-phenoxypropan-2-ol (PubChem CID 155490354) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-(6-amino-7H-purin-2-yl)-3-phenoxypropan-2-ol.
| Compound Name | 1-(6-amino-7H-purin-2-yl)-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 155490354 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-(6-amino-7H-purin-2-yl)-3-phenoxypropan-2-ol |
| SMILES | Nc1nc(CC(O)COc2ccccc2)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H15N5O2/c15-13-12-14(17-8-16-12)19-11(18-13)6-9(20)7-21-10-4-2-1-3-5-10/h1-5,8-9,20H,6-7H2,(H3,15,16,17,18,19) |
| InChIKey | YMMCGUGWKYIQKS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |