C12H11N5 — CID 15986830
2-benzyl-7H-purin-6-amine (PubChem CID 15986830) has the molecular formula C12H11N5 and a molecular weight of 225.26 g/mol. Its IUPAC name is 2-benzyl-7H-purin-6-amine.
| Compound Name | 2-benzyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 15986830 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-benzyl-7H-purin-6-amine |
| SMILES | Nc1nc(Cc2ccccc2)nc2nc[nH]c12 |
| InChI | InChI=1S/C12H11N5/c13-11-10-12(15-7-14-10)17-9(16-11)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H3,13,14,15,16,17) |
| InChIKey | LHPVTMAMEMZFIJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |