C16H19N5 — CID 23106936
2-benzyl-N-tert-butyl-7H-purin-6-amine (PubChem CID 23106936) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-benzyl-N-tert-butyl-7H-purin-6-amine.
| Compound Name | 2-benzyl-N-tert-butyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 23106936 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-benzyl-N-tert-butyl-7H-purin-6-amine |
| SMILES | CC(C)(C)Nc1nc(Cc2ccccc2)nc2nc[nH]c12 |
| InChI | InChI=1S/C16H19N5/c1-16(2,3)21-15-13-14(18-10-17-13)19-12(20-15)9-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3,(H2,17,18,19,20,21) |
| InChIKey | KQKXKPADJJEYHY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |