About 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine
2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine (PubChem CID 154249196) has the molecular formula C13H11Cl2N5
and a molecular weight of 308.17 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine.
Molecular Properties
| Compound Name | 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine |
| PubChem CID | 154249196 |
| Molecular Formula | C13H11Cl2N5 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine |
| SMILES | CNc1nc(Cc2c(Cl)cccc2Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C13H11Cl2N5/c1-16-12-11-13(18-6-17-11)20-10(19-12)5-7-8(14)3-2-4-9(7)15/h2-4,6H,5H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | ARWPBHRIVFXAEI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine?
The IUPAC name of 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine (CID 154249196) is 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine.
What is the SMILES notation for 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine?
The canonical SMILES for 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine is CNc1nc(Cc2c(Cl)cccc2Cl)nc2nc[nH]c12.
What is the InChIKey of 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine?
The InChIKey is ARWPBHRIVFXAEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2N5/c1-16-12-11-13(18-6-17-11)20-10(19-12)5-7-8(14)3-2-4-9(7)15/h2-4,6H,5H2,1H3,(H2,16,17,18,19,20).
What are the key properties of 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine?
2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine has a molecular weight of 308.17 g/mol, XLogP of 3.29, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dichlorophenyl)methyl]-N-methyl-7H-purin-6-amine is sourced from PubChem (CID 154249196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).