C14H13F2N5 — CID 70491805
2-[(2,6-difluorophenyl)methyl]-N,N-dimethyl-7H-purin-6-amine (PubChem CID 70491805) has the molecular formula C14H13F2N5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)methyl]-N,N-dimethyl-7H-purin-6-amine.
| Compound Name | 2-[(2,6-difluorophenyl)methyl]-N,N-dimethyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 70491805 |
| Molecular Formula | C14H13F2N5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[(2,6-difluorophenyl)methyl]-N,N-dimethyl-7H-purin-6-amine |
| SMILES | CN(C)c1nc(Cc2c(F)cccc2F)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H13F2N5/c1-21(2)14-12-13(18-7-17-12)19-11(20-14)6-8-9(15)4-3-5-10(8)16/h3-5,7H,6H2,1-2H3,(H,17,18,19,20) |
| InChIKey | RKISGZOGHMHEGM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |