C13H13FN6 — CID 104623147
6-N-[(2-fluorophenyl)methyl]-6-N-methyl-7H-purine-2,6-diamine (PubChem CID 104623147) has the molecular formula C13H13FN6 and a molecular weight of 272.29 g/mol. Its IUPAC name is 6-N-[(2-fluorophenyl)methyl]-6-N-methyl-7H-purine-2,6-diamine.
| Compound Name | 6-N-[(2-fluorophenyl)methyl]-6-N-methyl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 104623147 |
| Molecular Formula | C13H13FN6 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 6-N-[(2-fluorophenyl)methyl]-6-N-methyl-7H-purine-2,6-diamine |
| SMILES | CN(Cc1ccccc1F)c1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C13H13FN6/c1-20(6-8-4-2-3-5-9(8)14)12-10-11(17-7-16-10)18-13(15)19-12/h2-5,7H,6H2,1H3,(H3,15,16,17,18,19) |
| InChIKey | BANGMIMIQZWARX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |