C10H15N7O — CID 115669355
2-[(2-amino-7H-purin-6-yl)-methylamino]-N,N-dimethylacetamide (PubChem CID 115669355) has the molecular formula C10H15N7O and a molecular weight of 249.28 g/mol. Its IUPAC name is 2-[(2-amino-7H-purin-6-yl)-methylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(2-amino-7H-purin-6-yl)-methylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 115669355 |
| Molecular Formula | C10H15N7O |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-[(2-amino-7H-purin-6-yl)-methylamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN(C)c1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H15N7O/c1-16(2)6(18)4-17(3)9-7-8(13-5-12-7)14-10(11)15-9/h5H,4H2,1-3H3,(H3,11,12,13,14,15) |
| InChIKey | NKCOTFULDXYKLS-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |