C13H20N6O2 — CID 72941332
[4-[[(2-amino-7H-purin-6-yl)-methylamino]methyl]oxan-4-yl]methanol (PubChem CID 72941332) has the molecular formula C13H20N6O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is [4-[[(2-amino-7H-purin-6-yl)-methylamino]methyl]oxan-4-yl]methanol.
| Compound Name | [4-[[(2-amino-7H-purin-6-yl)-methylamino]methyl]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 72941332 |
| Molecular Formula | C13H20N6O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | [4-[[(2-amino-7H-purin-6-yl)-methylamino]methyl]oxan-4-yl]methanol |
| SMILES | CN(CC1(CO)CCOCC1)c1nc(N)nc2nc[nH]c12 |
| InChI | InChI=1S/C13H20N6O2/c1-19(6-13(7-20)2-4-21-5-3-13)11-9-10(16-8-15-9)17-12(14)18-11/h8,20H,2-7H2,1H3,(H3,14,15,16,17,18) |
| InChIKey | FYGDPIKJEXXTKI-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |